C8H12F2N4O — CID 7018494
(2R)-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanehydrazide (PubChem CID 7018494) has the molecular formula C8H12F2N4O and a molecular weight of 218.21 g/mol. Its IUPAC name is (2R)-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanehydrazide.
| Compound Name | (2R)-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 7018494 |
| Molecular Formula | C8H12F2N4O |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (2R)-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanehydrazide |
| SMILES | Cc1cc(C(F)F)nn1[C@H](C)C(=O)NN |
| InChI | InChI=1S/C8H12F2N4O/c1-4-3-6(7(9)10)13-14(4)5(2)8(15)12-11/h3,5,7H,11H2,1-2H3,(H,12,15)/t5-/m1/s1 |
| InChIKey | LMFGLKDQYMJMDO-RXMQYKEDSA-N |
| XLogP | 0.68 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|