C13H13F3N4OS — CID 171130784
2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[(5-fluorothiophen-2-yl)methylideneamino]propanamide (PubChem CID 171130784) has the molecular formula C13H13F3N4OS and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[(5-fluorothiophen-2-yl)methylideneamino]propanamide.
| Compound Name | 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[(5-fluorothiophen-2-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 171130784 |
| Molecular Formula | C13H13F3N4OS |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[(5-fluorothiophen-2-yl)methylideneamino]propanamide |
| SMILES | Cc1cc(C(F)F)nn1C(C)C(=O)NN=Cc1ccc(F)s1 |
| InChI | InChI=1S/C13H13F3N4OS/c1-7-5-10(12(15)16)19-20(7)8(2)13(21)18-17-6-9-3-4-11(14)22-9/h3-6,8,12H,1-2H3,(H,18,21) |
| InChIKey | GWKIMRDKXIZATN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|