C11H10ClFN4OS — CID 124845774
(2S)-2-(4-chloropyrazol-1-yl)-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]propanamide (PubChem CID 124845774) has the molecular formula C11H10ClFN4OS and a molecular weight of 300.75 g/mol. Its IUPAC name is (2S)-2-(4-chloropyrazol-1-yl)-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(4-chloropyrazol-1-yl)-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 124845774 |
| Molecular Formula | C11H10ClFN4OS |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (2S)-2-(4-chloropyrazol-1-yl)-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]propanamide |
| SMILES | C[C@@H](C(=O)N/N=C\c1ccc(F)s1)n1cc(Cl)cn1 |
| InChI | InChI=1S/C11H10ClFN4OS/c1-7(17-6-8(12)4-15-17)11(18)16-14-5-9-2-3-10(13)19-9/h2-7H,1H3,(H,16,18)/b14-5-/t7-/m0/s1 |
| InChIKey | HSTCQPIZRMOFFS-PYMFEVINSA-N |
| XLogP | 2.45 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|