C16H12ClFN4OS — CID 124849210
4-[(4-chloropyrazol-1-yl)methyl]-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]benzamide (PubChem CID 124849210) has the molecular formula C16H12ClFN4OS and a molecular weight of 362.82 g/mol. Its IUPAC name is 4-[(4-chloropyrazol-1-yl)methyl]-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-[(4-chloropyrazol-1-yl)methyl]-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 124849210 |
| Molecular Formula | C16H12ClFN4OS |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 4-[(4-chloropyrazol-1-yl)methyl]-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(F)s1)c1ccc(Cn2cc(Cl)cn2)cc1 |
| InChI | InChI=1S/C16H12ClFN4OS/c17-13-7-20-22(10-13)9-11-1-3-12(4-2-11)16(23)21-19-8-14-5-6-15(18)24-14/h1-8,10H,9H2,(H,21,23)/b19-8- |
| InChIKey | OFRAIIWUOMPPJO-UWVJOHFNSA-N |
| XLogP | 3.55 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|