C11H10BrFN4OS — CID 119055756
4-bromo-1-ethyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 119055756) has the molecular formula C11H10BrFN4OS and a molecular weight of 345.20 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119055756 |
| Molecular Formula | C11H10BrFN4OS |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 4-bromo-1-ethyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Br)c(C(=O)N/N=C/c2ccc(F)s2)n1 |
| InChI | InChI=1S/C11H10BrFN4OS/c1-2-17-6-8(12)10(16-17)11(18)15-14-5-7-3-4-9(13)19-7/h3-6H,2H2,1H3,(H,15,18)/b14-5+ |
| InChIKey | ZKUZKVBRPSDMEF-LHHJGKSTSA-N |
| XLogP | 2.63 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|