C8H12ClN3OS — CID 19538486
2-(4-chloropyrazol-1-yl)-N-(2-sulfanylethyl)propanamide (PubChem CID 19538486) has the molecular formula C8H12ClN3OS and a molecular weight of 233.72 g/mol. Its IUPAC name is 2-(4-chloropyrazol-1-yl)-N-(2-sulfanylethyl)propanamide.
| Compound Name | 2-(4-chloropyrazol-1-yl)-N-(2-sulfanylethyl)propanamide |
|---|---|
| PubChem CID | 19538486 |
| Molecular Formula | C8H12ClN3OS |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-(4-chloropyrazol-1-yl)-N-(2-sulfanylethyl)propanamide |
| SMILES | CC(C(=O)NCCS)n1cc(Cl)cn1 |
| InChI | InChI=1S/C8H12ClN3OS/c1-6(8(13)10-2-3-14)12-5-7(9)4-11-12/h4-6,14H,2-3H2,1H3,(H,10,13) |
| InChIKey | DXFODFQZRBLLFU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|