C12H11Cl3N4O — CID 61036168
N-(4-amino-2,6-dichlorophenyl)-2-(4-chloropyrazol-1-yl)propanamide (PubChem CID 61036168) has the molecular formula C12H11Cl3N4O and a molecular weight of 333.61 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-(4-chloropyrazol-1-yl)propanamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-(4-chloropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 61036168 |
| Molecular Formula | C12H11Cl3N4O |
| Molecular Weight | 333.61 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-(4-chloropyrazol-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1c(Cl)cc(N)cc1Cl)n1cc(Cl)cn1 |
| InChI | InChI=1S/C12H11Cl3N4O/c1-6(19-5-7(13)4-17-19)12(20)18-11-9(14)2-8(16)3-10(11)15/h2-6H,16H2,1H3,(H,18,20) |
| InChIKey | JTRFSYIVNFIEEX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|