C13H11ClF6N6O — CID 119056109
2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide (PubChem CID 119056109) has the molecular formula C13H11ClF6N6O and a molecular weight of 416.71 g/mol. Its IUPAC name is 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 119056109 |
| Molecular Formula | C13H11ClF6N6O |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CC(=O)N/N=C/c1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C13H11ClF6N6O/c1-7-10(14)11(13(18,19)20)24-26(7)5-9(27)22-21-4-8-2-3-25(23-8)6-12(15,16)17/h2-4H,5-6H2,1H3,(H,22,27)/b21-4+ |
| InChIKey | CLHQUDKGXKRSPK-IPBDZQFASA-N |
| XLogP | 2.77 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|