C15H14F3N5O4 — CID 124855029
2-(4-methyl-2-nitrophenoxy)-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide (PubChem CID 124855029) has the molecular formula C15H14F3N5O4 and a molecular weight of 385.30 g/mol. Its IUPAC name is 2-(4-methyl-2-nitrophenoxy)-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-methyl-2-nitrophenoxy)-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124855029 |
| Molecular Formula | C15H14F3N5O4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-(4-methyl-2-nitrophenoxy)-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1ccc(OCC(=O)N/N=C\c2ccn(CC(F)(F)F)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14F3N5O4/c1-10-2-3-13(12(6-10)23(25)26)27-8-14(24)20-19-7-11-4-5-22(21-11)9-15(16,17)18/h2-7H,8-9H2,1H3,(H,20,24)/b19-7- |
| InChIKey | YLEMVAAGUMZHMY-GXHLCREISA-N |
| XLogP | 2.19 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|