C14H12N3O8S- — CID 6886171
5-[(E)-[[2-(4-methyl-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 6886171) has the molecular formula C14H12N3O8S- and a molecular weight of 382.33 g/mol. Its IUPAC name is 5-[(E)-[[2-(4-methyl-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | 5-[(E)-[[2-(4-methyl-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 6886171 |
| Molecular Formula | C14H12N3O8S- |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 5-[(E)-[[2-(4-methyl-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | Cc1ccc(OCC(=O)N/N=C/c2ccc(S(=O)(=O)[O-])o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13N3O8S/c1-9-2-4-12(11(6-9)17(19)20)24-8-13(18)16-15-7-10-3-5-14(25-10)26(21,22)23/h2-7H,8H2,1H3,(H,16,18)(H,21,22,23)/p-1/b15-7+ |
| InChIKey | LJNPKFZLCSCWOC-VIZOYTHASA-M |
| XLogP | 0.93 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|