C21H26BrN3O5 — CID 2318407
N-[(5-bromofuran-2-yl)methylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide (PubChem CID 2318407) has the molecular formula C21H26BrN3O5 and a molecular weight of 480.36 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide.
| Compound Name | N-[(5-bromofuran-2-yl)methylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 2318407 |
| Molecular Formula | C21H26BrN3O5 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCC(=O)NN=Cc2ccc(Br)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26BrN3O5/c1-20(2,3)13-21(4,5)14-6-8-17(16(10-14)25(27)28)29-12-19(26)24-23-11-15-7-9-18(22)30-15/h6-11H,12-13H2,1-5H3,(H,24,26) |
| InChIKey | VOLAFZYPFIZLDB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|