C23H29N3O6 — CID 2305863
N-[(2,4-dihydroxyphenyl)methylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide (PubChem CID 2305863) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-[(2,4-dihydroxyphenyl)methylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide.
| Compound Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 2305863 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCC(=O)NN=Cc2ccc(O)cc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H29N3O6/c1-22(2,3)14-23(4,5)16-7-9-20(18(10-16)26(30)31)32-13-21(29)25-24-12-15-6-8-17(27)11-19(15)28/h6-12,27-28H,13-14H2,1-5H3,(H,25,29) |
| InChIKey | CGZPJBPOTUVKDJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|