C24H30BrN3O4 — CID 3130890
N-[1-(3-bromophenyl)ethylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide (PubChem CID 3130890) has the molecular formula C24H30BrN3O4 and a molecular weight of 504.43 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide.
| Compound Name | N-[1-(3-bromophenyl)ethylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 3130890 |
| Molecular Formula | C24H30BrN3O4 |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-[1-(3-bromophenyl)ethylideneamino]-2-[2-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
| SMILES | CC(=NNC(=O)COc1ccc(C(C)(C)CC(C)(C)C)cc1[N+](=O)[O-])c1cccc(Br)c1 |
| InChI | InChI=1S/C24H30BrN3O4/c1-16(17-8-7-9-19(25)12-17)26-27-22(29)14-32-21-11-10-18(13-20(21)28(30)31)24(5,6)15-23(2,3)4/h7-13H,14-15H2,1-6H3,(H,27,29) |
| InChIKey | DQTWBPDHOUZXIR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|