C24H31N3O4 — CID 6084898
N-[(Z)-1-(3-nitrophenyl)ethylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide (PubChem CID 6084898) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[(Z)-1-(3-nitrophenyl)ethylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide.
| Compound Name | N-[(Z)-1-(3-nitrophenyl)ethylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 6084898 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[(Z)-1-(3-nitrophenyl)ethylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
| SMILES | C/C(=N/NC(=O)COc1ccc(C(C)(C)CC(C)(C)C)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H31N3O4/c1-17(18-8-7-9-20(14-18)27(29)30)25-26-22(28)15-31-21-12-10-19(11-13-21)24(5,6)16-23(2,3)4/h7-14H,15-16H2,1-6H3,(H,26,28)/b25-17- |
| InChIKey | YAQUZMMMIJROJF-UQQQWYQISA-N |
| XLogP | 5.23 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|