C14H12N3NaO8S — CID 171151871
sodium 5-[[[2-(4-methyl-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 171151871) has the molecular formula C14H12N3NaO8S and a molecular weight of 405.32 g/mol. Its IUPAC name is sodium 5-[[[2-(4-methyl-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | sodium 5-[[[2-(4-methyl-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 171151871 |
| Molecular Formula | C14H12N3NaO8S |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | sodium 5-[[[2-(4-methyl-2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | Cc1ccc(OCC(=O)NN=Cc2ccc(S(=O)(=O)[O-])o2)c([N+](=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C14H13N3O8S.Na/c1-9-2-4-12(11(6-9)17(19)20)24-8-13(18)16-15-7-10-3-5-14(25-10)26(21,22)23;/h2-7H,8H2,1H3,(H,16,18)(H,21,22,23);/q;+1/p-1 |
| InChIKey | CZYGHUBEDSNCOS-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|