C13H14N4O — CID 840866
N-(benzylideneamino)-2-(5-methylpyrazol-1-yl)acetamide (PubChem CID 840866) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(benzylideneamino)-2-(5-methylpyrazol-1-yl)acetamide.
| Compound Name | N-(benzylideneamino)-2-(5-methylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 840866 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-(benzylideneamino)-2-(5-methylpyrazol-1-yl)acetamide |
| SMILES | Cc1ccnn1CC(=O)NN=Cc1ccccc1 |
| InChI | InChI=1S/C13H14N4O/c1-11-7-8-15-17(11)10-13(18)16-14-9-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,16,18) |
| InChIKey | ZPONMMYKYWSFFU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|