C16H16F3N5O4 — CID 146090656
2-[[2-(2-methyl-4-nitroimidazol-1-yl)acetyl]amino]-2-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 146090656) has the molecular formula C16H16F3N5O4 and a molecular weight of 399.33 g/mol. Its IUPAC name is 2-[[2-(2-methyl-4-nitroimidazol-1-yl)acetyl]amino]-2-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[[2-(2-methyl-4-nitroimidazol-1-yl)acetyl]amino]-2-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 146090656 |
| Molecular Formula | C16H16F3N5O4 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-[[2-(2-methyl-4-nitroimidazol-1-yl)acetyl]amino]-2-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1nc([N+](=O)[O-])cn1CC(=O)NC(C)(C(N)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3N5O4/c1-9-21-12(24(27)28)7-23(9)8-13(25)22-15(2,14(20)26)10-4-3-5-11(6-10)16(17,18)19/h3-7H,8H2,1-2H3,(H2,20,26)(H,22,25) |
| InChIKey | RHNSHXFSCJKRIP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|