C13H15F3N2O2S — CID 96528918
(2S)-2-[(2-methylsulfanylacetyl)amino]-2-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 96528918) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is (2S)-2-[(2-methylsulfanylacetyl)amino]-2-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-[(2-methylsulfanylacetyl)amino]-2-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 96528918 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (2S)-2-[(2-methylsulfanylacetyl)amino]-2-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CSCC(=O)N[C@](C)(C(N)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O2S/c1-12(11(17)20,18-10(19)7-21-2)8-4-3-5-9(6-8)13(14,15)16/h3-6H,7H2,1-2H3,(H2,17,20)(H,18,19)/t12-/m0/s1 |
| InChIKey | XMVFMACOXKPVGR-LBPRGKRZSA-N |
| XLogP | 1.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |