C16H14F3N3O2 — CID 71977558
N-[1-amino-1-oxo-2-[3-(trifluoromethyl)phenyl]propan-2-yl]pyridine-2-carboxamide (PubChem CID 71977558) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is N-[1-amino-1-oxo-2-[3-(trifluoromethyl)phenyl]propan-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[1-amino-1-oxo-2-[3-(trifluoromethyl)phenyl]propan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71977558 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[1-amino-1-oxo-2-[3-(trifluoromethyl)phenyl]propan-2-yl]pyridine-2-carboxamide |
| SMILES | CC(NC(=O)c1ccccn1)(C(N)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3N3O2/c1-15(14(20)24,22-13(23)12-7-2-3-8-21-12)10-5-4-6-11(9-10)16(17,18)19/h2-9H,1H3,(H2,20,24)(H,22,23) |
| InChIKey | GEBCFNYLWSQSMA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |