C20H16F3N3O3S — CID 169307902
N-[3-methyl-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]pyridine-2-carboxamide (PubChem CID 169307902) has the molecular formula C20H16F3N3O3S and a molecular weight of 435.43 g/mol. Its IUPAC name is N-[3-methyl-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]pyridine-2-carboxamide.
| Compound Name | N-[3-methyl-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169307902 |
| Molecular Formula | C20H16F3N3O3S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-[3-methyl-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccccn2)ccc1S(=O)(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3N3O3S/c1-13-11-15(25-19(27)17-7-2-3-10-24-17)8-9-18(13)30(28,29)26-16-6-4-5-14(12-16)20(21,22)23/h2-12,26H,1H3,(H,25,27) |
| InChIKey | GNQHYWPTUSWCLH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |