C11H13F3N2O6S — CID 160830202
[5-nitro-1-(5,5,5-trifluoro-2-oxopentyl)pyrrol-2-yl]methyl methanesulfonate (PubChem CID 160830202) has the molecular formula C11H13F3N2O6S and a molecular weight of 358.29 g/mol. Its IUPAC name is [5-nitro-1-(5,5,5-trifluoro-2-oxopentyl)pyrrol-2-yl]methyl methanesulfonate.
| Compound Name | [5-nitro-1-(5,5,5-trifluoro-2-oxopentyl)pyrrol-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 160830202 |
| Molecular Formula | C11H13F3N2O6S |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | [5-nitro-1-(5,5,5-trifluoro-2-oxopentyl)pyrrol-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1ccc([N+](=O)[O-])n1CC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O6S/c1-23(20,21)22-7-8-2-3-10(16(18)19)15(8)6-9(17)4-5-11(12,13)14/h2-3H,4-7H2,1H3 |
| InChIKey | GAVBVRVINJSGGV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 108.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|