C20H18F5NO6S — CID 159379044
[5-nitro-2-(5,5,6,6,6-pentafluoro-2-oxohexyl)phenyl]methyl 4-methylbenzenesulfonate (PubChem CID 159379044) has the molecular formula C20H18F5NO6S and a molecular weight of 495.42 g/mol. Its IUPAC name is [5-nitro-2-(5,5,6,6,6-pentafluoro-2-oxohexyl)phenyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [5-nitro-2-(5,5,6,6,6-pentafluoro-2-oxohexyl)phenyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159379044 |
| Molecular Formula | C20H18F5NO6S |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | [5-nitro-2-(5,5,6,6,6-pentafluoro-2-oxohexyl)phenyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2cc([N+](=O)[O-])ccc2CC(=O)CCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F5NO6S/c1-13-2-6-18(7-3-13)33(30,31)32-12-15-10-16(26(28)29)5-4-14(15)11-17(27)8-9-19(21,22)20(23,24)25/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | LZKWLVZDICMQRZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|