C18H17F5N2O6S — CID 160830205
[5-nitro-1-(5,5,6,6,6-pentafluoro-2-oxohexyl)pyrrol-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 160830205) has the molecular formula C18H17F5N2O6S and a molecular weight of 484.40 g/mol. Its IUPAC name is [5-nitro-1-(5,5,6,6,6-pentafluoro-2-oxohexyl)pyrrol-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [5-nitro-1-(5,5,6,6,6-pentafluoro-2-oxohexyl)pyrrol-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 160830205 |
| Molecular Formula | C18H17F5N2O6S |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | [5-nitro-1-(5,5,6,6,6-pentafluoro-2-oxohexyl)pyrrol-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2ccc([N+](=O)[O-])n2CC(=O)CCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F5N2O6S/c1-12-2-5-15(6-3-12)32(29,30)31-11-13-4-7-16(25(27)28)24(13)10-14(26)8-9-17(19,20)18(21,22)23/h2-7H,8-11H2,1H3 |
| InChIKey | RYAHNMVTALOPPK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 108.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|