About 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate
1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate (PubChem CID 158309299) has the molecular formula C28H26N2O7S
and a molecular weight of 534.59 g/mol. Its IUPAC name is 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate |
| PubChem CID | 158309299 |
| Molecular Formula | C28H26N2O7S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2ccccc2[N+](=O)[O-])cc1.O=[N+]([O-])c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C14H13NO5S.C14H13NO2/c1-11-6-8-13(9-7-11)21(18,19)20-10-12-4-2-3-5-14(12)15(16)17;16-15(17)14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12/h2-9H,10H2,1H3;1-9H,10-11H2 |
| InChIKey | GNMBSNCZNQNAJV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate?
The IUPAC name of 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate (CID 158309299) is 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate.
What is the SMILES notation for 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate?
The canonical SMILES for 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCc2ccccc2[N+](=O)[O-])cc1.O=[N+]([O-])c1ccccc1CCc1ccccc1.
What is the InChIKey of 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate?
The InChIKey is GNMBSNCZNQNAJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO5S.C14H13NO2/c1-11-6-8-13(9-7-11)21(18,19)20-10-12-4-2-3-5-14(12)15(16)17;16-15(17)14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12/h2-9H,10H2,1H3;1-9H,10-11H2.
What are the key properties of 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate?
1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate has a molecular weight of 534.59 g/mol, XLogP of 6.19, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-2-(2-phenylethyl)benzene;(2-nitrophenyl)methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 158309299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).