C21H24F2N7O8P — CID 134563463
4-amino-1-[(2R,4R,5R)-5-[[(benzylamino)-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]oxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 134563463) has the molecular formula C21H24F2N7O8P and a molecular weight of 571.43 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R,5R)-5-[[(benzylamino)-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]oxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4R,5R)-5-[[(benzylamino)-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]oxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 134563463 |
| Molecular Formula | C21H24F2N7O8P |
| Molecular Weight | 571.43 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 4-amino-1-[(2R,4R,5R)-5-[[(benzylamino)-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]oxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | Cn1c(COP(=O)(NCc2ccccc2)OC[C@H]2O[C@@H](n3ccc(N)nc3=O)C(F)(F)[C@@H]2O)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24F2N7O8P/c1-28-14(10-25-19(28)30(33)34)11-36-39(35,26-9-13-5-3-2-4-6-13)37-12-15-17(31)21(22,23)18(38-15)29-8-7-16(24)27-20(29)32/h2-8,10,15,17-18,31H,9,11-12H2,1H3,(H,26,35)(H2,24,27,32)/t15-,17-,18-,39?/m1/s1 |
| InChIKey | HKRXKWKUOOMWGI-PPYOTGOVSA-N |
| XLogP | 1.49 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|