C16H16F2N4O7P- — CID 102124648
N-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]benzenecarboximidate (PubChem CID 102124648) has the molecular formula C16H16F2N4O7P- and a molecular weight of 445.30 g/mol. Its IUPAC name is N-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]benzenecarboximidate.
| Compound Name | N-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]benzenecarboximidate |
|---|---|
| PubChem CID | 102124648 |
| Molecular Formula | C16H16F2N4O7P- |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]benzenecarboximidate |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)N=C([O-])c3ccccc3)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C16H17F2N4O7P/c17-16(18)12(23)10(29-14(16)22-7-6-11(19)20-15(22)25)8-28-30(26,27)21-13(24)9-4-2-1-3-5-9/h1-7,10,12,14,23H,8H2,(H2,19,20,25)(H2,21,24,26,27)/p-1/t10-,12-,14-/m1/s1 |
| InChIKey | FLTYXOKRJBGVOB-MPKXVKKWSA-M |
| XLogP | -0.36 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|