C15H27F2N4O7P — CID 172642442
[5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;triethylazanium (PubChem CID 172642442) has the molecular formula C15H27F2N4O7P and a molecular weight of 444.37 g/mol. Its IUPAC name is [5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;triethylazanium.
| Compound Name | [5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;triethylazanium |
|---|---|
| PubChem CID | 172642442 |
| Molecular Formula | C15H27F2N4O7P |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;triethylazanium |
| SMILES | CC[NH+](CC)CC.Nc1ccn(C2OC(COP(=O)([O-])O)C(O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C9H12F2N3O7P.C6H15N/c10-9(11)6(15)4(3-20-22(17,18)19)21-7(9)14-2-1-5(12)13-8(14)16;1-4-7(5-2)6-3/h1-2,4,6-7,15H,3H2,(H2,12,13,16)(H2,17,18,19);4-6H2,1-3H3 |
| InChIKey | JOCQSLAZJFSYFT-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 164.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|