C11H15FN3O7P — CID 174073362
[(2R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 174073362) has the molecular formula C11H15FN3O7P and a molecular weight of 351.23 g/mol. Its IUPAC name is [(2R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 174073362 |
| Molecular Formula | C11H15FN3O7P |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [(2R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C=C[C@@]1(F)C(O)[C@@H](COP(=O)(O)O)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C11H15FN3O7P/c1-2-11(12)8(16)6(5-21-23(18,19)20)22-9(11)15-4-3-7(13)14-10(15)17/h2-4,6,8-9,16H,1,5H2,(H2,13,14,17)(H2,18,19,20)/t6-,8?,9-,11-/m1/s1 |
| InChIKey | HHCJPRQRKPKIJX-PAGVCZNRSA-N |
| XLogP | -0.91 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|