C28H38F2N3O10P — CID 157410758
[(2R,3R,5R)-5-[4-[2-[(5,7-dimethyl-1-benzofuran-2-yl)methoxy]-2-oxoethyl]-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;triethylazanium (PubChem CID 157410758) has the molecular formula C28H38F2N3O10P and a molecular weight of 645.59 g/mol. Its IUPAC name is [(2R,3R,5R)-5-[4-[2-[(5,7-dimethyl-1-benzofuran-2-yl)methoxy]-2-oxoethyl]-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;triethylazanium.
| Compound Name | [(2R,3R,5R)-5-[4-[2-[(5,7-dimethyl-1-benzofuran-2-yl)methoxy]-2-oxoethyl]-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;triethylazanium |
|---|---|
| PubChem CID | 157410758 |
| Molecular Formula | C28H38F2N3O10P |
| Molecular Weight | 645.59 g/mol |
| Exact Mass | 645.23 |
| IUPAC Name | [(2R,3R,5R)-5-[4-[2-[(5,7-dimethyl-1-benzofuran-2-yl)methoxy]-2-oxoethyl]-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;triethylazanium |
| SMILES | CC[NH+](CC)CC.Cc1cc(C)c2oc(COC(=O)Cc3ccn([C@@H]4O[C@H](COP(=O)([O-])O)[C@@H](O)C4(F)F)c(=O)n3)cc2c1 |
| InChI | InChI=1S/C22H23F2N2O10P.C6H15N/c1-11-5-12(2)18-13(6-11)7-15(35-18)9-33-17(27)8-14-3-4-26(21(29)25-14)20-22(23,24)19(28)16(36-20)10-34-37(30,31)32;1-4-7(5-2)6-3/h3-7,16,19-20,28H,8-10H2,1-2H3,(H2,30,31,32);4-6H2,1-3H3/t16-,19-,20-;/m1./s1 |
| InChIKey | BOGLELLQFYECHN-GJYOXNSLSA-N |
| XLogP | 1.19 |
| TPSA | 177.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.59 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|