C19H20ClFN7O9+ — CID 166562496
2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-[(3-carboxy-2-methyl-1H-pyrazol-2-ium-5-yl)methyl]propanedioic acid (PubChem CID 166562496) has the molecular formula C19H20ClFN7O9+ and a molecular weight of 544.86 g/mol. Its IUPAC name is 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-[(3-carboxy-2-methyl-1H-pyrazol-2-ium-5-yl)methyl]propanedioic acid.
| Compound Name | 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-[(3-carboxy-2-methyl-1H-pyrazol-2-ium-5-yl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 166562496 |
| Molecular Formula | C19H20ClFN7O9+ |
| Molecular Weight | 544.86 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-[(3-carboxy-2-methyl-1H-pyrazol-2-ium-5-yl)methyl]propanedioic acid |
| SMILES | C[n+]1[nH]c(CC(OC[C@H]2O[C@@H](n3cnc4c(N)nc(Cl)nc43)[C@@H](F)[C@@H]2O)(C(=O)O)C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C19H19ClFN7O9/c1-27-7(15(30)31)2-6(26-27)3-19(16(32)33,17(34)35)36-4-8-11(29)9(21)14(37-8)28-5-23-10-12(22)24-18(20)25-13(10)28/h2,5,8-9,11,14,29H,3-4H2,1H3,(H5,22,24,25,30,31,32,33,34,35)/p+1/t8-,9+,11-,14-/m1/s1 |
| InChIKey | BEEYMEGAOSAXQX-SZRLZVLASA-O |
| XLogP | -1.32 |
| TPSA | 239.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.86 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|