C20H18ClF2N5O6 — CID 134336159
2-[[5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-[(3-fluorophenyl)methyl]propanedioic acid (PubChem CID 134336159) has the molecular formula C20H18ClF2N5O6 and a molecular weight of 497.84 g/mol. Its IUPAC name is 2-[[5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-[(3-fluorophenyl)methyl]propanedioic acid.
| Compound Name | 2-[[5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-[(3-fluorophenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 134336159 |
| Molecular Formula | C20H18ClF2N5O6 |
| Molecular Weight | 497.84 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 2-[[5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-[(3-fluorophenyl)methyl]propanedioic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2C1OC(COC(Cc2cccc(F)c2)(C(=O)O)C(=O)O)CC1F |
| InChI | InChI=1S/C20H18ClF2N5O6/c21-19-26-14(24)13-15(27-19)28(8-25-13)16-12(23)5-11(34-16)7-33-20(17(29)30,18(31)32)6-9-2-1-3-10(22)4-9/h1-4,8,11-12,16H,5-7H2,(H,29,30)(H,31,32)(H2,24,26,27) |
| InChIKey | QHUASJFEWNTKOD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.84 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|