C17H21ClFN5O7 — CID 134336051
2-[[(2S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-(4-hydroxybutyl)propanedioic acid (PubChem CID 134336051) has the molecular formula C17H21ClFN5O7 and a molecular weight of 461.83 g/mol. Its IUPAC name is 2-[[(2S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-(4-hydroxybutyl)propanedioic acid.
| Compound Name | 2-[[(2S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-(4-hydroxybutyl)propanedioic acid |
|---|---|
| PubChem CID | 134336051 |
| Molecular Formula | C17H21ClFN5O7 |
| Molecular Weight | 461.83 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 2-[[(2S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-(4-hydroxybutyl)propanedioic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(CCCCO)(C(=O)O)C(=O)O)C[C@@H]1F |
| InChI | InChI=1S/C17H21ClFN5O7/c18-16-22-11(20)10-12(23-16)24(7-21-10)13-9(19)5-8(31-13)6-30-17(14(26)27,15(28)29)3-1-2-4-25/h7-9,13,25H,1-6H2,(H,26,27)(H,28,29)(H2,20,22,23)/t8-,9-,13+/m0/s1 |
| InChIKey | HZIOCXOZJDDBHF-MWODSPESSA-N |
| XLogP | 0.77 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.83 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|