C15H21ClFN6O6P — CID 123978102
[5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy-N-(1-ethoxy-1-oxopropan-2-yl)phosphonamidic acid (PubChem CID 123978102) has the molecular formula C15H21ClFN6O6P and a molecular weight of 466.79 g/mol. Its IUPAC name is [5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy-N-(1-ethoxy-1-oxopropan-2-yl)phosphonamidic acid.
| Compound Name | [5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy-N-(1-ethoxy-1-oxopropan-2-yl)phosphonamidic acid |
|---|---|
| PubChem CID | 123978102 |
| Molecular Formula | C15H21ClFN6O6P |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy-N-(1-ethoxy-1-oxopropan-2-yl)phosphonamidic acid |
| SMILES | CCOC(=O)C(C)NP(=O)(O)OCC1CC(F)C(n2cnc3c(N)nc(Cl)nc32)O1 |
| InChI | InChI=1S/C15H21ClFN6O6P/c1-3-27-14(24)7(2)22-30(25,26)28-5-8-4-9(17)13(29-8)23-6-19-10-11(18)20-15(16)21-12(10)23/h6-9,13H,3-5H2,1-2H3,(H2,18,20,21)(H2,22,25,26) |
| InChIKey | VDMULUKTRKADIF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|