C16H21ClFN6O5P — CID 129033452
ethyl (2S)-2-[[(2R,3S,3aR,7aS)-2-(6-amino-2-chloropurin-9-yl)-3-fluoro-5-oxo-2,3,3a,4,7,7a-hexahydrofuro[3,2-d]oxaphosphinin-5-yl]amino]propanoate (PubChem CID 129033452) has the molecular formula C16H21ClFN6O5P and a molecular weight of 462.81 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2R,3S,3aR,7aS)-2-(6-amino-2-chloropurin-9-yl)-3-fluoro-5-oxo-2,3,3a,4,7,7a-hexahydrofuro[3,2-d]oxaphosphinin-5-yl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(2R,3S,3aR,7aS)-2-(6-amino-2-chloropurin-9-yl)-3-fluoro-5-oxo-2,3,3a,4,7,7a-hexahydrofuro[3,2-d]oxaphosphinin-5-yl]amino]propanoate |
|---|---|
| PubChem CID | 129033452 |
| Molecular Formula | C16H21ClFN6O5P |
| Molecular Weight | 462.81 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | ethyl (2S)-2-[[(2R,3S,3aR,7aS)-2-(6-amino-2-chloropurin-9-yl)-3-fluoro-5-oxo-2,3,3a,4,7,7a-hexahydrofuro[3,2-d]oxaphosphinin-5-yl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP1(=O)C[C@H]2[C@H](F)[C@H](n3cnc4c(N)nc(Cl)nc43)O[C@@H]2CO1 |
| InChI | InChI=1S/C16H21ClFN6O5P/c1-3-27-15(25)7(2)23-30(26)5-8-9(4-28-30)29-14(10(8)18)24-6-20-11-12(19)21-16(17)22-13(11)24/h6-10,14H,3-5H2,1-2H3,(H,23,26)(H2,19,21,22)/t7-,8+,9+,10-,14+,30?/m0/s1 |
| InChIKey | HNZHDOXQXWBPRV-LATGTSNCSA-N |
| XLogP | 1.68 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.81 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|