C15H19ClFN5O7P+ — CID 156564719
(2S)-4-[[(4aR,6R,7S,7aR)-6-(6-amino-2-chloropurin-9-yl)-7-fluoro-2-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-2-yl]oxy]-2-methylbutanoic acid (PubChem CID 156564719) has the molecular formula C15H19ClFN5O7P+ and a molecular weight of 466.77 g/mol. Its IUPAC name is (2S)-4-[[(4aR,6R,7S,7aR)-6-(6-amino-2-chloropurin-9-yl)-7-fluoro-2-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-2-yl]oxy]-2-methylbutanoic acid.
| Compound Name | (2S)-4-[[(4aR,6R,7S,7aR)-6-(6-amino-2-chloropurin-9-yl)-7-fluoro-2-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-2-yl]oxy]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 156564719 |
| Molecular Formula | C15H19ClFN5O7P+ |
| Molecular Weight | 466.77 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | (2S)-4-[[(4aR,6R,7S,7aR)-6-(6-amino-2-chloropurin-9-yl)-7-fluoro-2-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-2-yl]oxy]-2-methylbutanoic acid |
| SMILES | C[C@@H](CCO[P+]1(O)OC[C@H]2O[C@@H](n3cnc4c(N)nc(Cl)nc43)[C@@H](F)[C@@H]2O1)C(=O)O |
| InChI | InChI=1S/C15H18ClFN5O7P/c1-6(14(23)24)2-3-26-30(25)27-4-7-10(29-30)8(17)13(28-7)22-5-19-9-11(18)20-15(16)21-12(9)22/h5-8,10,13,25H,2-4H2,1H3,(H2-,18,20,21,23,24)/p+1/t6-,7+,8-,10+,13+,30?/m0/s1 |
| InChIKey | RRYTWGLKOSPVNI-SXIBGENLSA-O |
| XLogP | 1.51 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.77 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|