C12H12ClFN5O7P — CID 118550416
2-[[(4aR,6R,7R)-6-(6-amino-2-chloropurin-9-yl)-7-fluoro-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]acetic acid (PubChem CID 118550416) has the molecular formula C12H12ClFN5O7P and a molecular weight of 423.68 g/mol. Its IUPAC name is 2-[[(4aR,6R,7R)-6-(6-amino-2-chloropurin-9-yl)-7-fluoro-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]acetic acid.
| Compound Name | 2-[[(4aR,6R,7R)-6-(6-amino-2-chloropurin-9-yl)-7-fluoro-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 118550416 |
| Molecular Formula | C12H12ClFN5O7P |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 2-[[(4aR,6R,7R)-6-(6-amino-2-chloropurin-9-yl)-7-fluoro-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]acetic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(OCC(=O)O)OC2[C@H]1F |
| InChI | InChI=1S/C12H12ClFN5O7P/c13-12-17-9(15)7-10(18-12)19(3-16-7)11-6(14)8-4(25-11)1-23-27(22,26-8)24-2-5(20)21/h3-4,6,8,11H,1-2H2,(H,20,21)(H2,15,17,18)/t4-,6-,8?,11-,27?/m1/s1 |
| InChIKey | YDQYUNULUVVTLJ-LNRLSTOBSA-N |
| XLogP | 0.92 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|