C18H26ClFN5O6PS — CID 118550456
S-[2-[[(2S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy-methoxyphosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 118550456) has the molecular formula C18H26ClFN5O6PS and a molecular weight of 525.93 g/mol. Its IUPAC name is S-[2-[[(2S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy-methoxyphosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy-methoxyphosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 118550456 |
| Molecular Formula | C18H26ClFN5O6PS |
| Molecular Weight | 525.93 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | S-[2-[[(2S,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy-methoxyphosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | COP(OCCSC(=O)C(C)(C)CO)OC[C@@H]1C[C@H](F)[C@H](n2cnc3c(N)nc(Cl)nc32)O1 |
| InChI | InChI=1S/C18H26ClFN5O6PS/c1-18(2,8-26)16(27)33-5-4-29-32(28-3)30-7-10-6-11(20)15(31-10)25-9-22-12-13(21)23-17(19)24-14(12)25/h9-11,15,26H,4-8H2,1-3H3,(H2,21,23,24)/t10-,11-,15+,32?/m0/s1 |
| InChIKey | ZCVYEYZXFHLXBK-URBGBXTBSA-N |
| XLogP | 2.87 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.93 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|