C18H26ClN5O7PS+ — CID 129032522
[(E,3R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxy-2-methoxypent-4-enoxy]-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]-oxophosphanium (PubChem CID 129032522) has the molecular formula C18H26ClN5O7PS+ and a molecular weight of 522.93 g/mol. Its IUPAC name is [(E,3R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxy-2-methoxypent-4-enoxy]-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]-oxophosphanium.
| Compound Name | [(E,3R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxy-2-methoxypent-4-enoxy]-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]-oxophosphanium |
|---|---|
| PubChem CID | 129032522 |
| Molecular Formula | C18H26ClN5O7PS+ |
| Molecular Weight | 522.93 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | [(E,3R)-5-(6-amino-2-chloropurin-9-yl)-3-hydroxy-2-methoxypent-4-enoxy]-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]-oxophosphanium |
| SMILES | COC(CO[P+](=O)OCCSC(=O)C(C)(C)CO)[C@H](O)/C=C/n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C18H26ClN5O7PS/c1-18(2,9-25)16(27)33-7-6-30-32(28)31-8-12(29-3)11(26)4-5-24-10-21-13-14(20)22-17(19)23-15(13)24/h4-5,10-12,25-26H,6-9H2,1-3H3,(H2,20,22,23)/q+1/b5-4+/t11-,12?/m1/s1 |
| InChIKey | PXIJQXPYBWKBIV-YTCLHXHTSA-N |
| XLogP | 1.88 |
| TPSA | 171.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.93 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|