C25H37N6O9PS — CID 136598035
S-[2-[[(2R,3R,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-2-methoxypentoxy]-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 136598035) has the molecular formula C25H37N6O9PS and a molecular weight of 628.65 g/mol. Its IUPAC name is S-[2-[[(2R,3R,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-2-methoxypentoxy]-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3R,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-2-methoxypentoxy]-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 136598035 |
| Molecular Formula | C25H37N6O9PS |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | S-[2-[[(2R,3R,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-2-methoxypentoxy]-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CO[C@H](COP(=O)(NCc1ccccc1)OCCSC(=O)C(C)(C)CO)[C@@H](O)[C@@](C)(O)n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C25H37N6O9PS/c1-24(2,14-32)22(35)42-11-10-39-41(37,28-12-16-8-6-5-7-9-16)40-13-17(38-4)19(33)25(3,36)31-15-27-18-20(31)29-23(26)30-21(18)34/h5-9,15,17,19,32-33,36H,10-14H2,1-4H3,(H,28,37)(H3,26,29,30,34)/t17-,19-,25-,41?/m1/s1 |
| InChIKey | SHUVVWVMDXLAKG-QGRUTMCBSA-N |
| XLogP | 0.95 |
| TPSA | 224.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|