C24H34N5O5PS — CID 89148435
S-[2-[[(2R)-1-(7-aminoimidazo[4,5-b]pyridin-3-yl)propan-2-yl]oxymethyl-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 89148435) has the molecular formula C24H34N5O5PS and a molecular weight of 535.61 g/mol. Its IUPAC name is S-[2-[[(2R)-1-(7-aminoimidazo[4,5-b]pyridin-3-yl)propan-2-yl]oxymethyl-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R)-1-(7-aminoimidazo[4,5-b]pyridin-3-yl)propan-2-yl]oxymethyl-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 89148435 |
| Molecular Formula | C24H34N5O5PS |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | S-[2-[[(2R)-1-(7-aminoimidazo[4,5-b]pyridin-3-yl)propan-2-yl]oxymethyl-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | C[C@H](Cn1cnc2c(N)ccnc21)OCP(=O)(NCc1ccccc1)OCCSC(=O)C(C)(C)CO |
| InChI | InChI=1S/C24H34N5O5PS/c1-18(14-29-16-27-21-20(25)9-10-26-22(21)29)33-17-35(32,28-13-19-7-5-4-6-8-19)34-11-12-36-23(31)24(2,3)15-30/h4-10,16,18,30H,11-15,17H2,1-3H3,(H2,25,26)(H,28,32)/t18-,35?/m1/s1 |
| InChIKey | RVBYNTZSKWJRPL-ZUALZJRYSA-N |
| XLogP | 3.65 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|