C23H32N5O5P — CID 162068923
3-[(2R)-2-[[[[(1S)-1-(1,3-dioxepan-2-yl)ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]imidazo[4,5-b]pyridin-7-amine (PubChem CID 162068923) has the molecular formula C23H32N5O5P and a molecular weight of 489.51 g/mol. Its IUPAC name is 3-[(2R)-2-[[[[(1S)-1-(1,3-dioxepan-2-yl)ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 3-[(2R)-2-[[[[(1S)-1-(1,3-dioxepan-2-yl)ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162068923 |
| Molecular Formula | C23H32N5O5P |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 3-[(2R)-2-[[[[(1S)-1-(1,3-dioxepan-2-yl)ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]imidazo[4,5-b]pyridin-7-amine |
| SMILES | C[C@H](Cn1cnc2c(N)ccnc21)OC[P@](=O)(N[C@@H](C)C1OCCCCO1)Oc1ccccc1 |
| InChI | InChI=1S/C23H32N5O5P/c1-17(14-28-15-26-21-20(24)10-11-25-22(21)28)32-16-34(29,33-19-8-4-3-5-9-19)27-18(2)23-30-12-6-7-13-31-23/h3-5,8-11,15,17-18,23H,6-7,12-14,16H2,1-2H3,(H2,24,25)(H,27,29)/t17-,18+,34-/m1/s1 |
| InChIKey | IYXFCKJTYDDQCH-RQRDFJDXSA-N |
| XLogP | 3.78 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|