C27H24ClFN6O7 — CID 166843765
2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-[[4-(2-cyanophenyl)phenyl]methyl]propanedioic acid (PubChem CID 166843765) has the molecular formula C27H24ClFN6O7 and a molecular weight of 598.98 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-[[4-(2-cyanophenyl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-[[4-(2-cyanophenyl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 166843765 |
| Molecular Formula | C27H24ClFN6O7 |
| Molecular Weight | 598.98 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-[[4-(2-cyanophenyl)phenyl]methyl]propanedioic acid |
| SMILES | CO[C@H](COC(Cc1ccc(-c2ccccc2C#N)cc1)(C(=O)O)C(=O)O)[C@@H](O)[C@H](F)n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C27H24ClFN6O7/c1-41-18(20(36)21(29)35-13-32-19-22(31)33-26(28)34-23(19)35)12-42-27(24(37)38,25(39)40)10-14-6-8-15(9-7-14)17-5-3-2-4-16(17)11-30/h2-9,13,18,20-21,36H,10,12H2,1H3,(H,37,38)(H,39,40)(H2,31,33,34)/t18-,20-,21-/m1/s1 |
| InChIKey | HTHQKABYAHUURY-HMXCVIKNSA-N |
| XLogP | 2.61 |
| TPSA | 206.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.98 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|