C25H32ClN5O8 — CID 146406490
diethyl 2-[(2S)-2-[(1R,2R)-1-(6-amino-2-chloropurin-9-yl)-2-hydroxypropoxy]-3-hydroxypropoxy]-2-benzylpropanedioate (PubChem CID 146406490) has the molecular formula C25H32ClN5O8 and a molecular weight of 566.01 g/mol. Its IUPAC name is diethyl 2-[(2S)-2-[(1R,2R)-1-(6-amino-2-chloropurin-9-yl)-2-hydroxypropoxy]-3-hydroxypropoxy]-2-benzylpropanedioate.
| Compound Name | diethyl 2-[(2S)-2-[(1R,2R)-1-(6-amino-2-chloropurin-9-yl)-2-hydroxypropoxy]-3-hydroxypropoxy]-2-benzylpropanedioate |
|---|---|
| PubChem CID | 146406490 |
| Molecular Formula | C25H32ClN5O8 |
| Molecular Weight | 566.01 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | diethyl 2-[(2S)-2-[(1R,2R)-1-(6-amino-2-chloropurin-9-yl)-2-hydroxypropoxy]-3-hydroxypropoxy]-2-benzylpropanedioate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(OC[C@H](CO)O[C@H]([C@@H](C)O)n1cnc2c(N)nc(Cl)nc21)C(=O)OCC |
| InChI | InChI=1S/C25H32ClN5O8/c1-4-36-22(34)25(23(35)37-5-2,11-16-9-7-6-8-10-16)38-13-17(12-32)39-21(15(3)33)31-14-28-18-19(27)29-24(26)30-20(18)31/h6-10,14-15,17,21,32-33H,4-5,11-13H2,1-3H3,(H2,27,29,30)/t15-,17+,21-/m1/s1 |
| InChIKey | CGIMUEXBARCOCG-LDBYXDLTSA-N |
| XLogP | 1.44 |
| TPSA | 181.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.01 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|