C21H20ClF4N5O7 — CID 142302903
2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[[3-(trifluoromethoxy)phenyl]methyl]propanedioic acid (PubChem CID 142302903) has the molecular formula C21H20ClF4N5O7 and a molecular weight of 565.86 g/mol. Its IUPAC name is 2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[[3-(trifluoromethoxy)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[[3-(trifluoromethoxy)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 142302903 |
| Molecular Formula | C21H20ClF4N5O7 |
| Molecular Weight | 565.86 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | 2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[[3-(trifluoromethoxy)phenyl]methyl]propanedioic acid |
| SMILES | COC(COC(Cc1cccc(OC(F)(F)F)c1)(C(=O)O)C(=O)O)CC(F)n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C21H20ClF4N5O7/c1-36-12(6-13(23)31-9-28-14-15(27)29-19(22)30-16(14)31)8-37-20(17(32)33,18(34)35)7-10-3-2-4-11(5-10)38-21(24,25)26/h2-5,9,12-13H,6-8H2,1H3,(H,32,33)(H,34,35)(H2,27,29,30) |
| InChIKey | QQPBHEGNZBUSSR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 171.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|