C24H26ClN5O9 — CID 146282888
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-prop-1-en-2-yloxolan-2-yl]methoxy]-2-[(3-methoxyphenyl)methyl]propanedioic acid (PubChem CID 146282888) has the molecular formula C24H26ClN5O9 and a molecular weight of 563.95 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-prop-1-en-2-yloxolan-2-yl]methoxy]-2-[(3-methoxyphenyl)methyl]propanedioic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-prop-1-en-2-yloxolan-2-yl]methoxy]-2-[(3-methoxyphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 146282888 |
| Molecular Formula | C24H26ClN5O9 |
| Molecular Weight | 563.95 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-prop-1-en-2-yloxolan-2-yl]methoxy]-2-[(3-methoxyphenyl)methyl]propanedioic acid |
| SMILES | C=C(C)[C@@]1(O)[C@@H](COC(Cc2cccc(OC)c2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C24H26ClN5O9/c1-11(2)24(36)14(39-19(16(24)31)30-10-27-15-17(26)28-22(25)29-18(15)30)9-38-23(20(32)33,21(34)35)8-12-5-4-6-13(7-12)37-3/h4-7,10,14,16,19,31,36H,1,8-9H2,2-3H3,(H,32,33)(H,34,35)(H2,26,28,29)/t14-,16+,19-,24-/m1/s1 |
| InChIKey | UFILNIBEXLVEQF-UWAQFEQLSA-N |
| XLogP | 0.80 |
| TPSA | 212.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.95 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|