C17H23ClFN5O8 — CID 149002230
2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-(4-hydroxybutyl)propanedioic acid (PubChem CID 149002230) has the molecular formula C17H23ClFN5O8 and a molecular weight of 479.85 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-(4-hydroxybutyl)propanedioic acid.
| Compound Name | 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-(4-hydroxybutyl)propanedioic acid |
|---|---|
| PubChem CID | 149002230 |
| Molecular Formula | C17H23ClFN5O8 |
| Molecular Weight | 479.85 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-(4-hydroxybutyl)propanedioic acid |
| SMILES | CO[C@H](COC(CCCCO)(C(=O)O)C(=O)O)[C@@H](O)[C@H](F)n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C17H23ClFN5O8/c1-31-8(6-32-17(14(27)28,15(29)30)4-2-3-5-25)10(26)11(19)24-7-21-9-12(20)22-16(18)23-13(9)24/h7-8,10-11,25-26H,2-6H2,1H3,(H,27,28)(H,29,30)(H2,20,22,23)/t8-,10-,11-/m1/s1 |
| InChIKey | PZWOHMCMNLAWIY-FBIMIBRVSA-N |
| XLogP | -0.01 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.85 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|