C22H35N6O7PS — CID 143934398
S-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-morpholin-4-ylphosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 143934398) has the molecular formula C22H35N6O7PS and a molecular weight of 558.60 g/mol. Its IUPAC name is S-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-morpholin-4-ylphosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-morpholin-4-ylphosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 143934398 |
| Molecular Formula | C22H35N6O7PS |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | S-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-morpholin-4-ylphosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC1CC(COP(OCCSC(=O)C(C)(C)CO)N2CCOCC2)OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C22H35N6O7PS/c1-14-10-15(35-19(14)28-13-24-16-17(28)25-21(23)26-18(16)30)11-34-36(27-4-6-32-7-5-27)33-8-9-37-20(31)22(2,3)12-29/h13-15,19,29H,4-12H2,1-3H3,(H3,23,25,26,30) |
| InChIKey | HLNNTHKHCXWMPD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 167.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|