C24H23ClFN7O6 — CID 142302900
2-[[5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-[(1-benzylpyrazol-4-yl)methyl]propanedioic acid (PubChem CID 142302900) has the molecular formula C24H23ClFN7O6 and a molecular weight of 559.94 g/mol. Its IUPAC name is 2-[[5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-[(1-benzylpyrazol-4-yl)methyl]propanedioic acid.
| Compound Name | 2-[[5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-[(1-benzylpyrazol-4-yl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 142302900 |
| Molecular Formula | C24H23ClFN7O6 |
| Molecular Weight | 559.94 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | 2-[[5-(6-amino-2-chloropurin-9-yl)-4-fluorooxolan-2-yl]methoxy]-2-[(1-benzylpyrazol-4-yl)methyl]propanedioic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2C1OC(COC(Cc2cnn(Cc3ccccc3)c2)(C(=O)O)C(=O)O)CC1F |
| InChI | InChI=1S/C24H23ClFN7O6/c25-23-30-18(27)17-19(31-23)33(12-28-17)20-16(26)6-15(39-20)11-38-24(21(34)35,22(36)37)7-14-8-29-32(10-14)9-13-4-2-1-3-5-13/h1-5,8,10,12,15-16,20H,6-7,9,11H2,(H,34,35)(H,36,37)(H2,27,30,31) |
| InChIKey | GYBNBILRXFJPSV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 180.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.94 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|