C22H26ClN5O5 — CID 153379298
ethyl 2-[[5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]-3-oxopropanoate (PubChem CID 153379298) has the molecular formula C22H26ClN5O5 and a molecular weight of 475.93 g/mol. Its IUPAC name is ethyl 2-[[5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]-3-oxopropanoate.
| Compound Name | ethyl 2-[[5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]-3-oxopropanoate |
|---|---|
| PubChem CID | 153379298 |
| Molecular Formula | C22H26ClN5O5 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | ethyl 2-[[5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]-3-oxopropanoate |
| SMILES | C#CC1CC(n2cnc3c(NC4CCCC4)nc(Cl)nc32)OC1COC(C=O)C(=O)OCC |
| InChI | InChI=1S/C22H26ClN5O5/c1-3-13-9-17(33-16(13)11-32-15(10-29)21(30)31-4-2)28-12-24-18-19(25-14-7-5-6-8-14)26-22(23)27-20(18)28/h1,10,12-17H,4-9,11H2,2H3,(H,25,26,27) |
| InChIKey | NANDXSRLOYKLSL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|