C25H26ClN5O6 — CID 153300981
2-[[(2R,3S,4R,5R)-5-(2-chloro-6-pyrrolidin-1-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid (PubChem CID 153300981) has the molecular formula C25H26ClN5O6 and a molecular weight of 527.97 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(2-chloro-6-pyrrolidin-1-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(2-chloro-6-pyrrolidin-1-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 153300981 |
| Molecular Formula | C25H26ClN5O6 |
| Molecular Weight | 527.97 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(2-chloro-6-pyrrolidin-1-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)C(=O)O)O[C@@H](n2cnc3c(N4CCCC4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C25H26ClN5O6/c1-2-25(35)17(13-36-16(23(33)34)12-15-8-4-3-5-9-15)37-22(19(25)32)31-14-27-18-20(30-10-6-7-11-30)28-24(26)29-21(18)31/h1,3-5,8-9,14,16-17,19,22,32,35H,6-7,10-13H2,(H,33,34)/t16?,17-,19+,22-,25-/m1/s1 |
| InChIKey | PCELPOFLLVLRLX-CUNHJIGNSA-N |
| XLogP | 1.41 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.97 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|